C12H16BrN5O2S — CID 106077026
5-(aminomethyl)-2-bromo-N-[3-(triazol-1-yl)propyl]benzenesulfonamide (PubChem CID 106077026) has the molecular formula C12H16BrN5O2S and a molecular weight of 374.26 g/mol. Its IUPAC name is 5-(aminomethyl)-2-bromo-N-[3-(triazol-1-yl)propyl]benzenesulfonamide.
| Compound Name | 5-(aminomethyl)-2-bromo-N-[3-(triazol-1-yl)propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106077026 |
| Molecular Formula | C12H16BrN5O2S |
| Molecular Weight | 374.26 g/mol |
| Exact Mass | 373.02 |
| IUPAC Name | 5-(aminomethyl)-2-bromo-N-[3-(triazol-1-yl)propyl]benzenesulfonamide |
| SMILES | NCc1ccc(Br)c(S(=O)(=O)NCCCn2ccnn2)c1 |
| InChI | InChI=1S/C12H16BrN5O2S/c13-11-3-2-10(9-14)8-12(11)21(19,20)16-4-1-6-18-7-5-15-17-18/h2-3,5,7-8,16H,1,4,6,9,14H2 |
| InChIKey | WSAQGLYCNVKGSG-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.26 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|