C10H10BrFN4O2S — CID 116528824
4-bromo-2-fluoro-N-[2-(triazol-1-yl)ethyl]benzenesulfonamide (PubChem CID 116528824) has the molecular formula C10H10BrFN4O2S and a molecular weight of 349.19 g/mol. Its IUPAC name is 4-bromo-2-fluoro-N-[2-(triazol-1-yl)ethyl]benzenesulfonamide.
| Compound Name | 4-bromo-2-fluoro-N-[2-(triazol-1-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 116528824 |
| Molecular Formula | C10H10BrFN4O2S |
| Molecular Weight | 349.19 g/mol |
| Exact Mass | 347.97 |
| IUPAC Name | 4-bromo-2-fluoro-N-[2-(triazol-1-yl)ethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCn1ccnn1)c1ccc(Br)cc1F |
| InChI | InChI=1S/C10H10BrFN4O2S/c11-8-1-2-10(9(12)7-8)19(17,18)14-4-6-16-5-3-13-15-16/h1-3,5,7,14H,4,6H2 |
| InChIKey | LGILCKCBTBNPQB-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.19 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |