C11H14FN5O2S — CID 106077186
2-(aminomethyl)-5-fluoro-N-[2-(triazol-1-yl)ethyl]benzenesulfonamide (PubChem CID 106077186) has the molecular formula C11H14FN5O2S and a molecular weight of 299.33 g/mol. Its IUPAC name is 2-(aminomethyl)-5-fluoro-N-[2-(triazol-1-yl)ethyl]benzenesulfonamide.
| Compound Name | 2-(aminomethyl)-5-fluoro-N-[2-(triazol-1-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106077186 |
| Molecular Formula | C11H14FN5O2S |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 2-(aminomethyl)-5-fluoro-N-[2-(triazol-1-yl)ethyl]benzenesulfonamide |
| SMILES | NCc1ccc(F)cc1S(=O)(=O)NCCn1ccnn1 |
| InChI | InChI=1S/C11H14FN5O2S/c12-10-2-1-9(8-13)11(7-10)20(18,19)15-4-6-17-5-3-14-16-17/h1-3,5,7,15H,4,6,8,13H2 |
| InChIKey | FFECUWMYMNXGOJ-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |