C13H17FN4O2S — CID 106029754
2-(aminomethyl)-5-fluoro-N-(3-imidazol-1-ylpropyl)benzenesulfonamide (PubChem CID 106029754) has the molecular formula C13H17FN4O2S and a molecular weight of 312.37 g/mol. Its IUPAC name is 2-(aminomethyl)-5-fluoro-N-(3-imidazol-1-ylpropyl)benzenesulfonamide.
| Compound Name | 2-(aminomethyl)-5-fluoro-N-(3-imidazol-1-ylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106029754 |
| Molecular Formula | C13H17FN4O2S |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 2-(aminomethyl)-5-fluoro-N-(3-imidazol-1-ylpropyl)benzenesulfonamide |
| SMILES | NCc1ccc(F)cc1S(=O)(=O)NCCCn1ccnc1 |
| InChI | InChI=1S/C13H17FN4O2S/c14-12-3-2-11(9-15)13(8-12)21(19,20)17-4-1-6-18-7-5-16-10-18/h2-3,5,7-8,10,17H,1,4,6,9,15H2 |
| InChIKey | SMPIHNXMZZKBGP-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|