C13H22BrN3O2S2 — CID 106082684
5-(aminomethyl)-2-bromo-N-[2-(1-methylpiperidin-4-yl)ethyl]thiophene-3-sulfonamide (PubChem CID 106082684) has the molecular formula C13H22BrN3O2S2 and a molecular weight of 396.38 g/mol. Its IUPAC name is 5-(aminomethyl)-2-bromo-N-[2-(1-methylpiperidin-4-yl)ethyl]thiophene-3-sulfonamide.
| Compound Name | 5-(aminomethyl)-2-bromo-N-[2-(1-methylpiperidin-4-yl)ethyl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106082684 |
| Molecular Formula | C13H22BrN3O2S2 |
| Molecular Weight | 396.38 g/mol |
| Exact Mass | 395.03 |
| IUPAC Name | 5-(aminomethyl)-2-bromo-N-[2-(1-methylpiperidin-4-yl)ethyl]thiophene-3-sulfonamide |
| SMILES | CN1CCC(CCNS(=O)(=O)c2cc(CN)sc2Br)CC1 |
| InChI | InChI=1S/C13H22BrN3O2S2/c1-17-6-3-10(4-7-17)2-5-16-21(18,19)12-8-11(9-15)20-13(12)14/h8,10,16H,2-7,9,15H2,1H3 |
| InChIKey | VHURZVDMLKTLRZ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.38 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |