C9H15BrN2O3S2 — CID 106020201
5-(aminomethyl)-2-bromo-N-(2-ethoxyethyl)thiophene-3-sulfonamide (PubChem CID 106020201) has the molecular formula C9H15BrN2O3S2 and a molecular weight of 343.27 g/mol. Its IUPAC name is 5-(aminomethyl)-2-bromo-N-(2-ethoxyethyl)thiophene-3-sulfonamide.
| Compound Name | 5-(aminomethyl)-2-bromo-N-(2-ethoxyethyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106020201 |
| Molecular Formula | C9H15BrN2O3S2 |
| Molecular Weight | 343.27 g/mol |
| Exact Mass | 341.97 |
| IUPAC Name | 5-(aminomethyl)-2-bromo-N-(2-ethoxyethyl)thiophene-3-sulfonamide |
| SMILES | CCOCCNS(=O)(=O)c1cc(CN)sc1Br |
| InChI | InChI=1S/C9H15BrN2O3S2/c1-2-15-4-3-12-17(13,14)8-5-7(6-11)16-9(8)10/h5,12H,2-4,6,11H2,1H3 |
| InChIKey | VRVOOLHNERVWIF-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.27 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|