C10H16BrFN2O2S2 — CID 114267253
2-bromo-5-(ethylaminomethyl)-N-(3-fluoropropyl)thiophene-3-sulfonamide (PubChem CID 114267253) has the molecular formula C10H16BrFN2O2S2 and a molecular weight of 359.29 g/mol. Its IUPAC name is 2-bromo-5-(ethylaminomethyl)-N-(3-fluoropropyl)thiophene-3-sulfonamide.
| Compound Name | 2-bromo-5-(ethylaminomethyl)-N-(3-fluoropropyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 114267253 |
| Molecular Formula | C10H16BrFN2O2S2 |
| Molecular Weight | 359.29 g/mol |
| Exact Mass | 357.98 |
| IUPAC Name | 2-bromo-5-(ethylaminomethyl)-N-(3-fluoropropyl)thiophene-3-sulfonamide |
| SMILES | CCNCc1cc(S(=O)(=O)NCCCF)c(Br)s1 |
| InChI | InChI=1S/C10H16BrFN2O2S2/c1-2-13-7-8-6-9(10(11)17-8)18(15,16)14-5-3-4-12/h6,13-14H,2-5,7H2,1H3 |
| InChIKey | ZABFDRSHYQISQL-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.29 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|