C12H22BrN3O2S2 — CID 106074422
2-bromo-N-[1-(dimethylamino)propan-2-yl]-5-(ethylaminomethyl)thiophene-3-sulfonamide (PubChem CID 106074422) has the molecular formula C12H22BrN3O2S2 and a molecular weight of 384.37 g/mol. Its IUPAC name is 2-bromo-N-[1-(dimethylamino)propan-2-yl]-5-(ethylaminomethyl)thiophene-3-sulfonamide.
| Compound Name | 2-bromo-N-[1-(dimethylamino)propan-2-yl]-5-(ethylaminomethyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106074422 |
| Molecular Formula | C12H22BrN3O2S2 |
| Molecular Weight | 384.37 g/mol |
| Exact Mass | 383.03 |
| IUPAC Name | 2-bromo-N-[1-(dimethylamino)propan-2-yl]-5-(ethylaminomethyl)thiophene-3-sulfonamide |
| SMILES | CCNCc1cc(S(=O)(=O)NC(C)CN(C)C)c(Br)s1 |
| InChI | InChI=1S/C12H22BrN3O2S2/c1-5-14-7-10-6-11(12(13)19-10)20(17,18)15-9(2)8-16(3)4/h6,9,14-15H,5,7-8H2,1-4H3 |
| InChIKey | IDUCIRBLHJUPTP-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.37 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |