C13H23BrN2O2S2 — CID 106029847
2-bromo-N-(3-methylbutan-2-yl)-5-[(propan-2-ylamino)methyl]thiophene-3-sulfonamide (PubChem CID 106029847) has the molecular formula C13H23BrN2O2S2 and a molecular weight of 383.38 g/mol. Its IUPAC name is 2-bromo-N-(3-methylbutan-2-yl)-5-[(propan-2-ylamino)methyl]thiophene-3-sulfonamide.
| Compound Name | 2-bromo-N-(3-methylbutan-2-yl)-5-[(propan-2-ylamino)methyl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106029847 |
| Molecular Formula | C13H23BrN2O2S2 |
| Molecular Weight | 383.38 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | 2-bromo-N-(3-methylbutan-2-yl)-5-[(propan-2-ylamino)methyl]thiophene-3-sulfonamide |
| SMILES | CC(C)NCc1cc(S(=O)(=O)NC(C)C(C)C)c(Br)s1 |
| InChI | InChI=1S/C13H23BrN2O2S2/c1-8(2)10(5)16-20(17,18)12-6-11(19-13(12)14)7-15-9(3)4/h6,8-10,15-16H,7H2,1-5H3 |
| InChIKey | TWGHUSKVLSUZCR-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.38 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |