C13H23BrN2O3S2 — CID 106053935
2-bromo-N-(4-methoxybutyl)-5-[(propan-2-ylamino)methyl]thiophene-3-sulfonamide (PubChem CID 106053935) has the molecular formula C13H23BrN2O3S2 and a molecular weight of 399.38 g/mol. Its IUPAC name is 2-bromo-N-(4-methoxybutyl)-5-[(propan-2-ylamino)methyl]thiophene-3-sulfonamide.
| Compound Name | 2-bromo-N-(4-methoxybutyl)-5-[(propan-2-ylamino)methyl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106053935 |
| Molecular Formula | C13H23BrN2O3S2 |
| Molecular Weight | 399.38 g/mol |
| Exact Mass | 398.03 |
| IUPAC Name | 2-bromo-N-(4-methoxybutyl)-5-[(propan-2-ylamino)methyl]thiophene-3-sulfonamide |
| SMILES | COCCCCNS(=O)(=O)c1cc(CNC(C)C)sc1Br |
| InChI | InChI=1S/C13H23BrN2O3S2/c1-10(2)15-9-11-8-12(13(14)20-11)21(17,18)16-6-4-5-7-19-3/h8,10,15-16H,4-7,9H2,1-3H3 |
| InChIKey | WHGYSNIGKFSJGT-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.38 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|