C12H21BrN2O2S2 — CID 106018991
2-bromo-5-(methylaminomethyl)-N-(2-methylpentan-3-yl)thiophene-3-sulfonamide (PubChem CID 106018991) has the molecular formula C12H21BrN2O2S2 and a molecular weight of 369.35 g/mol. Its IUPAC name is 2-bromo-5-(methylaminomethyl)-N-(2-methylpentan-3-yl)thiophene-3-sulfonamide.
| Compound Name | 2-bromo-5-(methylaminomethyl)-N-(2-methylpentan-3-yl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106018991 |
| Molecular Formula | C12H21BrN2O2S2 |
| Molecular Weight | 369.35 g/mol |
| Exact Mass | 368.02 |
| IUPAC Name | 2-bromo-5-(methylaminomethyl)-N-(2-methylpentan-3-yl)thiophene-3-sulfonamide |
| SMILES | CCC(NS(=O)(=O)c1cc(CNC)sc1Br)C(C)C |
| InChI | InChI=1S/C12H21BrN2O2S2/c1-5-10(8(2)3)15-19(16,17)11-6-9(7-14-4)18-12(11)13/h6,8,10,14-15H,5,7H2,1-4H3 |
| InChIKey | NODUJNVQKOZWKZ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.35 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |