C12H21BrN2O3S2 — CID 106086828
2-bromo-N-(2-ethoxy-2-methylpropyl)-5-(methylaminomethyl)thiophene-3-sulfonamide (PubChem CID 106086828) has the molecular formula C12H21BrN2O3S2 and a molecular weight of 385.35 g/mol. Its IUPAC name is 2-bromo-N-(2-ethoxy-2-methylpropyl)-5-(methylaminomethyl)thiophene-3-sulfonamide.
| Compound Name | 2-bromo-N-(2-ethoxy-2-methylpropyl)-5-(methylaminomethyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106086828 |
| Molecular Formula | C12H21BrN2O3S2 |
| Molecular Weight | 385.35 g/mol |
| Exact Mass | 384.02 |
| IUPAC Name | 2-bromo-N-(2-ethoxy-2-methylpropyl)-5-(methylaminomethyl)thiophene-3-sulfonamide |
| SMILES | CCOC(C)(C)CNS(=O)(=O)c1cc(CNC)sc1Br |
| InChI | InChI=1S/C12H21BrN2O3S2/c1-5-18-12(2,3)8-15-20(16,17)10-6-9(7-14-4)19-11(10)13/h6,14-15H,5,7-8H2,1-4H3 |
| InChIKey | UEMJXKBLDVUTLC-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.35 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |