C13H24N2O3S2 — CID 106068684
N-(1-methoxy-3-methylbutan-2-yl)-2-methyl-5-(methylaminomethyl)thiophene-3-sulfonamide (PubChem CID 106068684) has the molecular formula C13H24N2O3S2 and a molecular weight of 320.48 g/mol. Its IUPAC name is N-(1-methoxy-3-methylbutan-2-yl)-2-methyl-5-(methylaminomethyl)thiophene-3-sulfonamide.
| Compound Name | N-(1-methoxy-3-methylbutan-2-yl)-2-methyl-5-(methylaminomethyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106068684 |
| Molecular Formula | C13H24N2O3S2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | N-(1-methoxy-3-methylbutan-2-yl)-2-methyl-5-(methylaminomethyl)thiophene-3-sulfonamide |
| SMILES | CNCc1cc(S(=O)(=O)NC(COC)C(C)C)c(C)s1 |
| InChI | InChI=1S/C13H24N2O3S2/c1-9(2)12(8-18-5)15-20(16,17)13-6-11(7-14-4)19-10(13)3/h6,9,12,14-15H,7-8H2,1-5H3 |
| InChIKey | VXMDOHRQLZIPDZ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |