C15H28N2O2S2 — CID 106053785
2-methyl-N-(3-methylpentan-2-yl)-5-[(propan-2-ylamino)methyl]thiophene-3-sulfonamide (PubChem CID 106053785) has the molecular formula C15H28N2O2S2 and a molecular weight of 332.54 g/mol. Its IUPAC name is 2-methyl-N-(3-methylpentan-2-yl)-5-[(propan-2-ylamino)methyl]thiophene-3-sulfonamide.
| Compound Name | 2-methyl-N-(3-methylpentan-2-yl)-5-[(propan-2-ylamino)methyl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106053785 |
| Molecular Formula | C15H28N2O2S2 |
| Molecular Weight | 332.54 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 2-methyl-N-(3-methylpentan-2-yl)-5-[(propan-2-ylamino)methyl]thiophene-3-sulfonamide |
| SMILES | CCC(C)C(C)NS(=O)(=O)c1cc(CNC(C)C)sc1C |
| InChI | InChI=1S/C15H28N2O2S2/c1-7-11(4)12(5)17-21(18,19)15-8-14(20-13(15)6)9-16-10(2)3/h8,10-12,16-17H,7,9H2,1-6H3 |
| InChIKey | ZYWBHYLZDBYAAB-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.54 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |