About N-[(4,5-dimethylthiophen-2-yl)methyl]propan-2-amine
N-[(4,5-dimethylthiophen-2-yl)methyl]propan-2-amine (PubChem CID 59237373) has the molecular formula C10H17NS
and a molecular weight of 183.32 g/mol. Its IUPAC name is N-[(4,5-dimethylthiophen-2-yl)methyl]propan-2-amine.
Analyze N-[(4,5-dimethylthiophen-2-yl)methyl]propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4,5-dimethylthiophen-2-yl)methyl]propan-2-amine?
The IUPAC name of N-[(4,5-dimethylthiophen-2-yl)methyl]propan-2-amine (CID 59237373) is N-[(4,5-dimethylthiophen-2-yl)methyl]propan-2-amine.
What is the SMILES notation for N-[(4,5-dimethylthiophen-2-yl)methyl]propan-2-amine?
The canonical SMILES for N-[(4,5-dimethylthiophen-2-yl)methyl]propan-2-amine is Cc1cc(CNC(C)C)sc1C.
What is the InChIKey of N-[(4,5-dimethylthiophen-2-yl)methyl]propan-2-amine?
The InChIKey is MXWURCFIWLYBQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NS/c1-7(2)11-6-10-5-8(3)9(4)12-10/h5,7,11H,6H2,1-4H3.
What are the key properties of N-[(4,5-dimethylthiophen-2-yl)methyl]propan-2-amine?
N-[(4,5-dimethylthiophen-2-yl)methyl]propan-2-amine has a molecular weight of 183.32 g/mol, XLogP of 2.86, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4,5-dimethylthiophen-2-yl)methyl]propan-2-amine is sourced from PubChem (CID 59237373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).