C14H23NS — CID 115891774
N-[(4,5-dimethylthiophen-2-yl)methyl]-3-methylhex-5-en-2-amine (PubChem CID 115891774) has the molecular formula C14H23NS and a molecular weight of 237.41 g/mol. Its IUPAC name is N-[(4,5-dimethylthiophen-2-yl)methyl]-3-methylhex-5-en-2-amine.
| Compound Name | N-[(4,5-dimethylthiophen-2-yl)methyl]-3-methylhex-5-en-2-amine |
|---|---|
| PubChem CID | 115891774 |
| Molecular Formula | C14H23NS |
| Molecular Weight | 237.41 g/mol |
| Exact Mass | 237.16 |
| IUPAC Name | N-[(4,5-dimethylthiophen-2-yl)methyl]-3-methylhex-5-en-2-amine |
| SMILES | C=CCC(C)C(C)NCc1cc(C)c(C)s1 |
| InChI | InChI=1S/C14H23NS/c1-6-7-10(2)12(4)15-9-14-8-11(3)13(5)16-14/h6,8,10,12,15H,1,7,9H2,2-5H3 |
| InChIKey | OPDNQNRCSAJAKF-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.41 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|