About N-[(4,5-dimethylthiophen-2-yl)methyl]-1-methylsulfonylpropan-2-amine
N-[(4,5-dimethylthiophen-2-yl)methyl]-1-methylsulfonylpropan-2-amine (PubChem CID 65246063) has the molecular formula C11H19NO2S2
and a molecular weight of 261.41 g/mol. Its IUPAC name is N-[(4,5-dimethylthiophen-2-yl)methyl]-1-methylsulfonylpropan-2-amine.
Molecular Properties
| Compound Name | N-[(4,5-dimethylthiophen-2-yl)methyl]-1-methylsulfonylpropan-2-amine |
| PubChem CID | 65246063 |
| Molecular Formula | C11H19NO2S2 |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | N-[(4,5-dimethylthiophen-2-yl)methyl]-1-methylsulfonylpropan-2-amine |
| SMILES | Cc1cc(CNC(C)CS(C)(=O)=O)sc1C |
| InChI | InChI=1S/C11H19NO2S2/c1-8-5-11(15-10(8)3)6-12-9(2)7-16(4,13)14/h5,9,12H,6-7H2,1-4H3 |
| InChIKey | DCCZRRWGGOLWLT-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(4,5-dimethylthiophen-2-yl)methyl]-1-methylsulfonylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4,5-dimethylthiophen-2-yl)methyl]-1-methylsulfonylpropan-2-amine?
The IUPAC name of N-[(4,5-dimethylthiophen-2-yl)methyl]-1-methylsulfonylpropan-2-amine (CID 65246063) is N-[(4,5-dimethylthiophen-2-yl)methyl]-1-methylsulfonylpropan-2-amine.
What is the SMILES notation for N-[(4,5-dimethylthiophen-2-yl)methyl]-1-methylsulfonylpropan-2-amine?
The canonical SMILES for N-[(4,5-dimethylthiophen-2-yl)methyl]-1-methylsulfonylpropan-2-amine is Cc1cc(CNC(C)CS(C)(=O)=O)sc1C.
What is the InChIKey of N-[(4,5-dimethylthiophen-2-yl)methyl]-1-methylsulfonylpropan-2-amine?
The InChIKey is DCCZRRWGGOLWLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO2S2/c1-8-5-11(15-10(8)3)6-12-9(2)7-16(4,13)14/h5,9,12H,6-7H2,1-4H3.
What are the key properties of N-[(4,5-dimethylthiophen-2-yl)methyl]-1-methylsulfonylpropan-2-amine?
N-[(4,5-dimethylthiophen-2-yl)methyl]-1-methylsulfonylpropan-2-amine has a molecular weight of 261.41 g/mol, XLogP of 1.89, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4,5-dimethylthiophen-2-yl)methyl]-1-methylsulfonylpropan-2-amine is sourced from PubChem (CID 65246063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).