C8H12ClNO2S2 — CID 65245746
1-chloro-N-[(4,5-dimethylthiophen-2-yl)methyl]methanesulfonamide (PubChem CID 65245746) has the molecular formula C8H12ClNO2S2 and a molecular weight of 253.78 g/mol. Its IUPAC name is 1-chloro-N-[(4,5-dimethylthiophen-2-yl)methyl]methanesulfonamide.
| Compound Name | 1-chloro-N-[(4,5-dimethylthiophen-2-yl)methyl]methanesulfonamide |
|---|---|
| PubChem CID | 65245746 |
| Molecular Formula | C8H12ClNO2S2 |
| Molecular Weight | 253.78 g/mol |
| Exact Mass | 253.00 |
| IUPAC Name | 1-chloro-N-[(4,5-dimethylthiophen-2-yl)methyl]methanesulfonamide |
| SMILES | Cc1cc(CNS(=O)(=O)CCl)sc1C |
| InChI | InChI=1S/C8H12ClNO2S2/c1-6-3-8(13-7(6)2)4-10-14(11,12)5-9/h3,10H,4-5H2,1-2H3 |
| InChIKey | KFOARXXOPFUGMM-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.78 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|