C13H15ClN2O2S2 — CID 65246459
3-amino-4-chloro-N-[(4,5-dimethylthiophen-2-yl)methyl]benzenesulfonamide (PubChem CID 65246459) has the molecular formula C13H15ClN2O2S2 and a molecular weight of 330.86 g/mol. Its IUPAC name is 3-amino-4-chloro-N-[(4,5-dimethylthiophen-2-yl)methyl]benzenesulfonamide.
| Compound Name | 3-amino-4-chloro-N-[(4,5-dimethylthiophen-2-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 65246459 |
| Molecular Formula | C13H15ClN2O2S2 |
| Molecular Weight | 330.86 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | 3-amino-4-chloro-N-[(4,5-dimethylthiophen-2-yl)methyl]benzenesulfonamide |
| SMILES | Cc1cc(CNS(=O)(=O)c2ccc(Cl)c(N)c2)sc1C |
| InChI | InChI=1S/C13H15ClN2O2S2/c1-8-5-10(19-9(8)2)7-16-20(17,18)11-3-4-12(14)13(15)6-11/h3-6,16H,7,15H2,1-2H3 |
| InChIKey | NLBQKNRXCFMRFI-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.86 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|