C15H17NO3S2 — CID 65244040
4-acetyl-N-[(4,5-dimethylthiophen-2-yl)methyl]benzenesulfonamide (PubChem CID 65244040) has the molecular formula C15H17NO3S2 and a molecular weight of 323.44 g/mol. Its IUPAC name is 4-acetyl-N-[(4,5-dimethylthiophen-2-yl)methyl]benzenesulfonamide.
| Compound Name | 4-acetyl-N-[(4,5-dimethylthiophen-2-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 65244040 |
| Molecular Formula | C15H17NO3S2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 4-acetyl-N-[(4,5-dimethylthiophen-2-yl)methyl]benzenesulfonamide |
| SMILES | CC(=O)c1ccc(S(=O)(=O)NCc2cc(C)c(C)s2)cc1 |
| InChI | InChI=1S/C15H17NO3S2/c1-10-8-14(20-12(10)3)9-16-21(18,19)15-6-4-13(5-7-15)11(2)17/h4-8,16H,9H2,1-3H3 |
| InChIKey | HLXDEUHXXOPNEP-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |