About 4-acetyl-N-[(3,5-dichlorophenyl)methyl]benzenesulfonamide
4-acetyl-N-[(3,5-dichlorophenyl)methyl]benzenesulfonamide (PubChem CID 5013211) has the molecular formula C15H13Cl2NO3S
and a molecular weight of 358.25 g/mol. Its IUPAC name is 4-acetyl-N-[(3,5-dichlorophenyl)methyl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-acetyl-N-[(3,5-dichlorophenyl)methyl]benzenesulfonamide |
| PubChem CID | 5013211 |
| Molecular Formula | C15H13Cl2NO3S |
| Molecular Weight | 358.25 g/mol |
| Exact Mass | 357.00 |
| IUPAC Name | 4-acetyl-N-[(3,5-dichlorophenyl)methyl]benzenesulfonamide |
| SMILES | CC(=O)c1ccc(S(=O)(=O)NCc2cc(Cl)cc(Cl)c2)cc1 |
| InChI | InChI=1S/C15H13Cl2NO3S/c1-10(19)12-2-4-15(5-3-12)22(20,21)18-9-11-6-13(16)8-14(17)7-11/h2-8,18H,9H2,1H3 |
| InChIKey | QGTVIGZOBJQOTG-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.25 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-acetyl-N-[(3,5-dichlorophenyl)methyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-acetyl-N-[(3,5-dichlorophenyl)methyl]benzenesulfonamide?
The IUPAC name of 4-acetyl-N-[(3,5-dichlorophenyl)methyl]benzenesulfonamide (CID 5013211) is 4-acetyl-N-[(3,5-dichlorophenyl)methyl]benzenesulfonamide.
What is the SMILES notation for 4-acetyl-N-[(3,5-dichlorophenyl)methyl]benzenesulfonamide?
The canonical SMILES for 4-acetyl-N-[(3,5-dichlorophenyl)methyl]benzenesulfonamide is CC(=O)c1ccc(S(=O)(=O)NCc2cc(Cl)cc(Cl)c2)cc1.
What is the InChIKey of 4-acetyl-N-[(3,5-dichlorophenyl)methyl]benzenesulfonamide?
The InChIKey is QGTVIGZOBJQOTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13Cl2NO3S/c1-10(19)12-2-4-15(5-3-12)22(20,21)18-9-11-6-13(16)8-14(17)7-11/h2-8,18H,9H2,1H3.
What are the key properties of 4-acetyl-N-[(3,5-dichlorophenyl)methyl]benzenesulfonamide?
4-acetyl-N-[(3,5-dichlorophenyl)methyl]benzenesulfonamide has a molecular weight of 358.25 g/mol, XLogP of 3.67, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-acetyl-N-[(3,5-dichlorophenyl)methyl]benzenesulfonamide is sourced from PubChem (CID 5013211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).