C15H13Cl2NO3S — CID 5013211
4-acetyl-N-[(3,5-dichlorophenyl)methyl]benzenesulfonamide (PubChem CID 5013211) has the molecular formula C15H13Cl2NO3S and a molecular weight of 358.25 g/mol. Its IUPAC name is 4-acetyl-N-[(3,5-dichlorophenyl)methyl]benzenesulfonamide.
| Compound Name | 4-acetyl-N-[(3,5-dichlorophenyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 5013211 |
| Molecular Formula | C15H13Cl2NO3S |
| Molecular Weight | 358.25 g/mol |
| Exact Mass | 357.00 |
| IUPAC Name | 4-acetyl-N-[(3,5-dichlorophenyl)methyl]benzenesulfonamide |
| SMILES | CC(=O)c1ccc(S(=O)(=O)NCc2cc(Cl)cc(Cl)c2)cc1 |
| InChI | InChI=1S/C15H13Cl2NO3S/c1-10(19)12-2-4-15(5-3-12)22(20,21)18-9-11-6-13(16)8-14(17)7-11/h2-8,18H,9H2,1H3 |
| InChIKey | QGTVIGZOBJQOTG-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.25 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |