C36H44N2O8S2 — CID 159833289
bis(N-[(4-acetylphenyl)methyl]-4-hydroxy-3-methylbenzenesulfonamide);2-methylpropane (PubChem CID 159833289) has the molecular formula C36H44N2O8S2 and a molecular weight of 696.89 g/mol. Its IUPAC name is bis(N-[(4-acetylphenyl)methyl]-4-hydroxy-3-methylbenzenesulfonamide);2-methylpropane.
| Compound Name | bis(N-[(4-acetylphenyl)methyl]-4-hydroxy-3-methylbenzenesulfonamide);2-methylpropane |
|---|---|
| PubChem CID | 159833289 |
| Molecular Formula | C36H44N2O8S2 |
| Molecular Weight | 696.89 g/mol |
| Exact Mass | 696.25 |
| IUPAC Name | bis(N-[(4-acetylphenyl)methyl]-4-hydroxy-3-methylbenzenesulfonamide);2-methylpropane |
| SMILES | CC(=O)c1ccc(CNS(=O)(=O)c2ccc(O)c(C)c2)cc1.CC(=O)c1ccc(CNS(=O)(=O)c2ccc(O)c(C)c2)cc1.CC(C)C |
| InChI | InChI=1S/2C16H17NO4S.C4H10/c2*1-11-9-15(7-8-16(11)19)22(20,21)17-10-13-3-5-14(6-4-13)12(2)18;1-4(2)3/h2*3-9,17,19H,10H2,1-2H3;4H,1-3H3 |
| InChIKey | NNSOGYGTFUOCRT-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 166.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.89 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |