C23H21FN2O4S — CID 34228029
4-[[(4-acetylphenyl)sulfonylamino]methyl]-N-(3-fluoro-4-methylphenyl)benzamide (PubChem CID 34228029) has the molecular formula C23H21FN2O4S and a molecular weight of 440.50 g/mol. Its IUPAC name is 4-[[(4-acetylphenyl)sulfonylamino]methyl]-N-(3-fluoro-4-methylphenyl)benzamide.
| Compound Name | 4-[[(4-acetylphenyl)sulfonylamino]methyl]-N-(3-fluoro-4-methylphenyl)benzamide |
|---|---|
| PubChem CID | 34228029 |
| Molecular Formula | C23H21FN2O4S |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | 4-[[(4-acetylphenyl)sulfonylamino]methyl]-N-(3-fluoro-4-methylphenyl)benzamide |
| SMILES | CC(=O)c1ccc(S(=O)(=O)NCc2ccc(C(=O)Nc3ccc(C)c(F)c3)cc2)cc1 |
| InChI | InChI=1S/C23H21FN2O4S/c1-15-3-10-20(13-22(15)24)26-23(28)19-6-4-17(5-7-19)14-25-31(29,30)21-11-8-18(9-12-21)16(2)27/h3-13,25H,14H2,1-2H3,(H,26,28) |
| InChIKey | UKYVDRNPKYMLMK-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |