C16H12F2N2O3S — CID 33314597
N-(3,4-difluorophenyl)-4-(prop-2-ynylsulfamoyl)benzamide (PubChem CID 33314597) has the molecular formula C16H12F2N2O3S and a molecular weight of 350.35 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-4-(prop-2-ynylsulfamoyl)benzamide.
| Compound Name | N-(3,4-difluorophenyl)-4-(prop-2-ynylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 33314597 |
| Molecular Formula | C16H12F2N2O3S |
| Molecular Weight | 350.35 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | N-(3,4-difluorophenyl)-4-(prop-2-ynylsulfamoyl)benzamide |
| SMILES | C#CCNS(=O)(=O)c1ccc(C(=O)Nc2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C16H12F2N2O3S/c1-2-9-19-24(22,23)13-6-3-11(4-7-13)16(21)20-12-5-8-14(17)15(18)10-12/h1,3-8,10,19H,9H2,(H,20,21) |
| InChIKey | NYRDIUIVSNMDHB-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.35 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|