C24H20FN3O4S — CID 55948629
3-fluoro-N-[3-[[[4-(prop-2-ynylsulfamoyl)benzoyl]amino]methyl]phenyl]benzamide (PubChem CID 55948629) has the molecular formula C24H20FN3O4S and a molecular weight of 465.51 g/mol. Its IUPAC name is 3-fluoro-N-[3-[[[4-(prop-2-ynylsulfamoyl)benzoyl]amino]methyl]phenyl]benzamide.
| Compound Name | 3-fluoro-N-[3-[[[4-(prop-2-ynylsulfamoyl)benzoyl]amino]methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 55948629 |
| Molecular Formula | C24H20FN3O4S |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | 3-fluoro-N-[3-[[[4-(prop-2-ynylsulfamoyl)benzoyl]amino]methyl]phenyl]benzamide |
| SMILES | C#CCNS(=O)(=O)c1ccc(C(=O)NCc2cccc(NC(=O)c3cccc(F)c3)c2)cc1 |
| InChI | InChI=1S/C24H20FN3O4S/c1-2-13-27-33(31,32)22-11-9-18(10-12-22)23(29)26-16-17-5-3-8-21(14-17)28-24(30)19-6-4-7-20(25)15-19/h1,3-12,14-15,27H,13,16H2,(H,26,29)(H,28,30) |
| InChIKey | OBZKOATUCCPVAD-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|