C26H23N3O4S — CID 38267137
4-[[(4-acetylphenyl)sulfonylamino]methyl]-N-(8-methylquinolin-5-yl)benzamide (PubChem CID 38267137) has the molecular formula C26H23N3O4S and a molecular weight of 473.55 g/mol. Its IUPAC name is 4-[[(4-acetylphenyl)sulfonylamino]methyl]-N-(8-methylquinolin-5-yl)benzamide.
| Compound Name | 4-[[(4-acetylphenyl)sulfonylamino]methyl]-N-(8-methylquinolin-5-yl)benzamide |
|---|---|
| PubChem CID | 38267137 |
| Molecular Formula | C26H23N3O4S |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | 4-[[(4-acetylphenyl)sulfonylamino]methyl]-N-(8-methylquinolin-5-yl)benzamide |
| SMILES | CC(=O)c1ccc(S(=O)(=O)NCc2ccc(C(=O)Nc3ccc(C)c4ncccc34)cc2)cc1 |
| InChI | InChI=1S/C26H23N3O4S/c1-17-5-14-24(23-4-3-15-27-25(17)23)29-26(31)21-8-6-19(7-9-21)16-28-34(32,33)22-12-10-20(11-13-22)18(2)30/h3-15,28H,16H2,1-2H3,(H,29,31) |
| InChIKey | UKDUAHDTVLPFKA-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |