C24H23N5O4S — CID 55729309
4-[[(4-acetylphenyl)sulfonylamino]methyl]-N-[2-[(3-cyano-2-pyridinyl)amino]ethyl]benzamide (PubChem CID 55729309) has the molecular formula C24H23N5O4S and a molecular weight of 477.55 g/mol. Its IUPAC name is 4-[[(4-acetylphenyl)sulfonylamino]methyl]-N-[2-[(3-cyano-2-pyridinyl)amino]ethyl]benzamide.
| Compound Name | 4-[[(4-acetylphenyl)sulfonylamino]methyl]-N-[2-[(3-cyano-2-pyridinyl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 55729309 |
| Molecular Formula | C24H23N5O4S |
| Molecular Weight | 477.55 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | 4-[[(4-acetylphenyl)sulfonylamino]methyl]-N-[2-[(3-cyano-2-pyridinyl)amino]ethyl]benzamide |
| SMILES | CC(=O)c1ccc(S(=O)(=O)NCc2ccc(C(=O)NCCNc3ncccc3C#N)cc2)cc1 |
| InChI | InChI=1S/C24H23N5O4S/c1-17(30)19-8-10-22(11-9-19)34(32,33)29-16-18-4-6-20(7-5-18)24(31)28-14-13-27-23-21(15-25)3-2-12-26-23/h2-12,29H,13-14,16H2,1H3,(H,26,27)(H,28,31) |
| InChIKey | NKAIAUUKKXBKDF-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 141.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.55 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|