C20H18N4O4S — CID 55727924
5-(benzenesulfonylmethyl)-N-[2-[(3-cyano-2-pyridinyl)amino]ethyl]furan-2-carboxamide (PubChem CID 55727924) has the molecular formula C20H18N4O4S and a molecular weight of 410.46 g/mol. Its IUPAC name is 5-(benzenesulfonylmethyl)-N-[2-[(3-cyano-2-pyridinyl)amino]ethyl]furan-2-carboxamide.
| Compound Name | 5-(benzenesulfonylmethyl)-N-[2-[(3-cyano-2-pyridinyl)amino]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55727924 |
| Molecular Formula | C20H18N4O4S |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | 5-(benzenesulfonylmethyl)-N-[2-[(3-cyano-2-pyridinyl)amino]ethyl]furan-2-carboxamide |
| SMILES | N#Cc1cccnc1NCCNC(=O)c1ccc(CS(=O)(=O)c2ccccc2)o1 |
| InChI | InChI=1S/C20H18N4O4S/c21-13-15-5-4-10-22-19(15)23-11-12-24-20(25)18-9-8-16(28-18)14-29(26,27)17-6-2-1-3-7-17/h1-10H,11-12,14H2,(H,22,23)(H,24,25) |
| InChIKey | AVQHBJXQSWZGTI-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 125.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|