C18H16N2O4S — CID 51155551
5-(benzenesulfonylmethyl)-N-(pyridin-4-ylmethyl)furan-2-carboxamide (PubChem CID 51155551) has the molecular formula C18H16N2O4S and a molecular weight of 356.40 g/mol. Its IUPAC name is 5-(benzenesulfonylmethyl)-N-(pyridin-4-ylmethyl)furan-2-carboxamide.
| Compound Name | 5-(benzenesulfonylmethyl)-N-(pyridin-4-ylmethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 51155551 |
| Molecular Formula | C18H16N2O4S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | 5-(benzenesulfonylmethyl)-N-(pyridin-4-ylmethyl)furan-2-carboxamide |
| SMILES | O=C(NCc1ccncc1)c1ccc(CS(=O)(=O)c2ccccc2)o1 |
| InChI | InChI=1S/C18H16N2O4S/c21-18(20-12-14-8-10-19-11-9-14)17-7-6-15(24-17)13-25(22,23)16-4-2-1-3-5-16/h1-11H,12-13H2,(H,20,21) |
| InChIKey | WFZBCVNTOUGIOY-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |