C21H18N4O4S — CID 55653064
5-(benzenesulfonylmethyl)-N-[(2-pyrazol-1-yl-3-pyridinyl)methyl]furan-2-carboxamide (PubChem CID 55653064) has the molecular formula C21H18N4O4S and a molecular weight of 422.47 g/mol. Its IUPAC name is 5-(benzenesulfonylmethyl)-N-[(2-pyrazol-1-yl-3-pyridinyl)methyl]furan-2-carboxamide.
| Compound Name | 5-(benzenesulfonylmethyl)-N-[(2-pyrazol-1-yl-3-pyridinyl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55653064 |
| Molecular Formula | C21H18N4O4S |
| Molecular Weight | 422.47 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | 5-(benzenesulfonylmethyl)-N-[(2-pyrazol-1-yl-3-pyridinyl)methyl]furan-2-carboxamide |
| SMILES | O=C(NCc1cccnc1-n1cccn1)c1ccc(CS(=O)(=O)c2ccccc2)o1 |
| InChI | InChI=1S/C21H18N4O4S/c26-21(23-14-16-6-4-11-22-20(16)25-13-5-12-24-25)19-10-9-17(29-19)15-30(27,28)18-7-2-1-3-8-18/h1-13H,14-15H2,(H,23,26) |
| InChIKey | UGMUAFMCDOLSDH-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 107.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.47 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |