C22H22ClNO5S — CID 24524461
5-(benzenesulfonylmethyl)-N-[4-(4-chlorophenoxy)butyl]furan-2-carboxamide (PubChem CID 24524461) has the molecular formula C22H22ClNO5S and a molecular weight of 447.94 g/mol. Its IUPAC name is 5-(benzenesulfonylmethyl)-N-[4-(4-chlorophenoxy)butyl]furan-2-carboxamide.
| Compound Name | 5-(benzenesulfonylmethyl)-N-[4-(4-chlorophenoxy)butyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 24524461 |
| Molecular Formula | C22H22ClNO5S |
| Molecular Weight | 447.94 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | 5-(benzenesulfonylmethyl)-N-[4-(4-chlorophenoxy)butyl]furan-2-carboxamide |
| SMILES | O=C(NCCCCOc1ccc(Cl)cc1)c1ccc(CS(=O)(=O)c2ccccc2)o1 |
| InChI | InChI=1S/C22H22ClNO5S/c23-17-8-10-18(11-9-17)28-15-5-4-14-24-22(25)21-13-12-19(29-21)16-30(26,27)20-6-2-1-3-7-20/h1-3,6-13H,4-5,14-16H2,(H,24,25) |
| InChIKey | VZIHPIJBTYSUDC-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.94 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|