C22H22ClNO4S — CID 46513558
5-(benzenesulfonylmethyl)-N-[1-(4-chlorophenyl)-2-methylpropyl]furan-2-carboxamide (PubChem CID 46513558) has the molecular formula C22H22ClNO4S and a molecular weight of 431.94 g/mol. Its IUPAC name is 5-(benzenesulfonylmethyl)-N-[1-(4-chlorophenyl)-2-methylpropyl]furan-2-carboxamide.
| Compound Name | 5-(benzenesulfonylmethyl)-N-[1-(4-chlorophenyl)-2-methylpropyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 46513558 |
| Molecular Formula | C22H22ClNO4S |
| Molecular Weight | 431.94 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | 5-(benzenesulfonylmethyl)-N-[1-(4-chlorophenyl)-2-methylpropyl]furan-2-carboxamide |
| SMILES | CC(C)C(NC(=O)c1ccc(CS(=O)(=O)c2ccccc2)o1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H22ClNO4S/c1-15(2)21(16-8-10-17(23)11-9-16)24-22(25)20-13-12-18(28-20)14-29(26,27)19-6-4-3-5-7-19/h3-13,15,21H,14H2,1-2H3,(H,24,25) |
| InChIKey | XQJHGVYJDWITEL-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.94 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |