C17H19NO6S — CID 75429137
3-[[5-(benzenesulfonylmethyl)furan-2-carbonyl]amino]-3-methylbutanoic acid (PubChem CID 75429137) has the molecular formula C17H19NO6S and a molecular weight of 365.41 g/mol. Its IUPAC name is 3-[[5-(benzenesulfonylmethyl)furan-2-carbonyl]amino]-3-methylbutanoic acid.
| Compound Name | 3-[[5-(benzenesulfonylmethyl)furan-2-carbonyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 75429137 |
| Molecular Formula | C17H19NO6S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 3-[[5-(benzenesulfonylmethyl)furan-2-carbonyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)(CC(=O)O)NC(=O)c1ccc(CS(=O)(=O)c2ccccc2)o1 |
| InChI | InChI=1S/C17H19NO6S/c1-17(2,10-15(19)20)18-16(21)14-9-8-12(24-14)11-25(22,23)13-6-4-3-5-7-13/h3-9H,10-11H2,1-2H3,(H,18,21)(H,19,20) |
| InChIKey | APCAHXNGYZXENW-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |