C20H19NO5S — CID 26736329
5-(benzenesulfonylmethyl)-N-(2-ethoxyphenyl)furan-2-carboxamide (PubChem CID 26736329) has the molecular formula C20H19NO5S and a molecular weight of 385.44 g/mol. Its IUPAC name is 5-(benzenesulfonylmethyl)-N-(2-ethoxyphenyl)furan-2-carboxamide.
| Compound Name | 5-(benzenesulfonylmethyl)-N-(2-ethoxyphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 26736329 |
| Molecular Formula | C20H19NO5S |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | 5-(benzenesulfonylmethyl)-N-(2-ethoxyphenyl)furan-2-carboxamide |
| SMILES | CCOc1ccccc1NC(=O)c1ccc(CS(=O)(=O)c2ccccc2)o1 |
| InChI | InChI=1S/C20H19NO5S/c1-2-25-18-11-7-6-10-17(18)21-20(22)19-13-12-15(26-19)14-27(23,24)16-8-4-3-5-9-16/h3-13H,2,14H2,1H3,(H,21,22) |
| InChIKey | LORBLHKXPKBQTG-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |