C23H26N2O6S2 — CID 26520481
5-(benzenesulfonylmethyl)-N-[5-(diethylsulfamoyl)-2-methylphenyl]furan-2-carboxamide (PubChem CID 26520481) has the molecular formula C23H26N2O6S2 and a molecular weight of 490.60 g/mol. Its IUPAC name is 5-(benzenesulfonylmethyl)-N-[5-(diethylsulfamoyl)-2-methylphenyl]furan-2-carboxamide.
| Compound Name | 5-(benzenesulfonylmethyl)-N-[5-(diethylsulfamoyl)-2-methylphenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 26520481 |
| Molecular Formula | C23H26N2O6S2 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | 5-(benzenesulfonylmethyl)-N-[5-(diethylsulfamoyl)-2-methylphenyl]furan-2-carboxamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C)c(NC(=O)c2ccc(CS(=O)(=O)c3ccccc3)o2)c1 |
| InChI | InChI=1S/C23H26N2O6S2/c1-4-25(5-2)33(29,30)20-13-11-17(3)21(15-20)24-23(26)22-14-12-18(31-22)16-32(27,28)19-9-7-6-8-10-19/h6-15H,4-5,16H2,1-3H3,(H,24,26) |
| InChIKey | DGZXJSFWASJOOV-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |