C21H21ClN2O5S — CID 24564244
5-(2-chlorophenyl)-N-[5-(diethylsulfamoyl)-2-hydroxyphenyl]furan-2-carboxamide (PubChem CID 24564244) has the molecular formula C21H21ClN2O5S and a molecular weight of 448.93 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-N-[5-(diethylsulfamoyl)-2-hydroxyphenyl]furan-2-carboxamide.
| Compound Name | 5-(2-chlorophenyl)-N-[5-(diethylsulfamoyl)-2-hydroxyphenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 24564244 |
| Molecular Formula | C21H21ClN2O5S |
| Molecular Weight | 448.93 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | 5-(2-chlorophenyl)-N-[5-(diethylsulfamoyl)-2-hydroxyphenyl]furan-2-carboxamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(O)c(NC(=O)c2ccc(-c3ccccc3Cl)o2)c1 |
| InChI | InChI=1S/C21H21ClN2O5S/c1-3-24(4-2)30(27,28)14-9-10-18(25)17(13-14)23-21(26)20-12-11-19(29-20)15-7-5-6-8-16(15)22/h5-13,25H,3-4H2,1-2H3,(H,23,26) |
| InChIKey | NVGKIHAWPUGURC-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.93 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|