C19H23ClN2O4S2 — CID 55464247
2-[(4-chlorophenyl)methylsulfanyl]-N-[5-(diethylsulfamoyl)-2-hydroxyphenyl]acetamide (PubChem CID 55464247) has the molecular formula C19H23ClN2O4S2 and a molecular weight of 442.99 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methylsulfanyl]-N-[5-(diethylsulfamoyl)-2-hydroxyphenyl]acetamide.
| Compound Name | 2-[(4-chlorophenyl)methylsulfanyl]-N-[5-(diethylsulfamoyl)-2-hydroxyphenyl]acetamide |
|---|---|
| PubChem CID | 55464247 |
| Molecular Formula | C19H23ClN2O4S2 |
| Molecular Weight | 442.99 g/mol |
| Exact Mass | 442.08 |
| IUPAC Name | 2-[(4-chlorophenyl)methylsulfanyl]-N-[5-(diethylsulfamoyl)-2-hydroxyphenyl]acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(O)c(NC(=O)CSCc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C19H23ClN2O4S2/c1-3-22(4-2)28(25,26)16-9-10-18(23)17(11-16)21-19(24)13-27-12-14-5-7-15(20)8-6-14/h5-11,23H,3-4,12-13H2,1-2H3,(H,21,24) |
| InChIKey | IHWYFHDTBLXLTC-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.99 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|