C22H32N4O3S2 — CID 55667081
N-[2-(diethylamino)-5-(diethylsulfamoyl)phenyl]-2-(pyridin-3-ylmethylsulfanyl)acetamide (PubChem CID 55667081) has the molecular formula C22H32N4O3S2 and a molecular weight of 464.66 g/mol. Its IUPAC name is N-[2-(diethylamino)-5-(diethylsulfamoyl)phenyl]-2-(pyridin-3-ylmethylsulfanyl)acetamide.
| Compound Name | N-[2-(diethylamino)-5-(diethylsulfamoyl)phenyl]-2-(pyridin-3-ylmethylsulfanyl)acetamide |
|---|---|
| PubChem CID | 55667081 |
| Molecular Formula | C22H32N4O3S2 |
| Molecular Weight | 464.66 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | N-[2-(diethylamino)-5-(diethylsulfamoyl)phenyl]-2-(pyridin-3-ylmethylsulfanyl)acetamide |
| SMILES | CCN(CC)c1ccc(S(=O)(=O)N(CC)CC)cc1NC(=O)CSCc1cccnc1 |
| InChI | InChI=1S/C22H32N4O3S2/c1-5-25(6-2)21-12-11-19(31(28,29)26(7-3)8-4)14-20(21)24-22(27)17-30-16-18-10-9-13-23-15-18/h9-15H,5-8,16-17H2,1-4H3,(H,24,27) |
| InChIKey | BKVMGPOJPBUMDN-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.66 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |