C23H33N3O5S2 — CID 16562748
N-[2-(diethylamino)-5-(diethylsulfamoyl)phenyl]-3-(methylsulfonylmethyl)benzamide (PubChem CID 16562748) has the molecular formula C23H33N3O5S2 and a molecular weight of 495.67 g/mol. Its IUPAC name is N-[2-(diethylamino)-5-(diethylsulfamoyl)phenyl]-3-(methylsulfonylmethyl)benzamide.
| Compound Name | N-[2-(diethylamino)-5-(diethylsulfamoyl)phenyl]-3-(methylsulfonylmethyl)benzamide |
|---|---|
| PubChem CID | 16562748 |
| Molecular Formula | C23H33N3O5S2 |
| Molecular Weight | 495.67 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | N-[2-(diethylamino)-5-(diethylsulfamoyl)phenyl]-3-(methylsulfonylmethyl)benzamide |
| SMILES | CCN(CC)c1ccc(S(=O)(=O)N(CC)CC)cc1NC(=O)c1cccc(CS(C)(=O)=O)c1 |
| InChI | InChI=1S/C23H33N3O5S2/c1-6-25(7-2)22-14-13-20(33(30,31)26(8-3)9-4)16-21(22)24-23(27)19-12-10-11-18(15-19)17-32(5,28)29/h10-16H,6-9,17H2,1-5H3,(H,24,27) |
| InChIKey | WVPMWYNWFJQHSO-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.67 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |