C23H31F2N3O5S — CID 55330865
N-[2-(diethylamino)-5-(diethylsulfamoyl)phenyl]-2-(difluoromethoxy)-3-methoxybenzamide (PubChem CID 55330865) has the molecular formula C23H31F2N3O5S and a molecular weight of 499.58 g/mol. Its IUPAC name is N-[2-(diethylamino)-5-(diethylsulfamoyl)phenyl]-2-(difluoromethoxy)-3-methoxybenzamide.
| Compound Name | N-[2-(diethylamino)-5-(diethylsulfamoyl)phenyl]-2-(difluoromethoxy)-3-methoxybenzamide |
|---|---|
| PubChem CID | 55330865 |
| Molecular Formula | C23H31F2N3O5S |
| Molecular Weight | 499.58 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | N-[2-(diethylamino)-5-(diethylsulfamoyl)phenyl]-2-(difluoromethoxy)-3-methoxybenzamide |
| SMILES | CCN(CC)c1ccc(S(=O)(=O)N(CC)CC)cc1NC(=O)c1cccc(OC)c1OC(F)F |
| InChI | InChI=1S/C23H31F2N3O5S/c1-6-27(7-2)19-14-13-16(34(30,31)28(8-3)9-4)15-18(19)26-22(29)17-11-10-12-20(32-5)21(17)33-23(24)25/h10-15,23H,6-9H2,1-5H3,(H,26,29) |
| InChIKey | QDLAYSBKXWFPPZ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.58 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |