C20H28N4O3S — CID 26880756
N-[2-(diethylamino)-5-(diethylsulfamoyl)phenyl]pyridine-2-carboxamide (PubChem CID 26880756) has the molecular formula C20H28N4O3S and a molecular weight of 404.54 g/mol. Its IUPAC name is N-[2-(diethylamino)-5-(diethylsulfamoyl)phenyl]pyridine-2-carboxamide.
| Compound Name | N-[2-(diethylamino)-5-(diethylsulfamoyl)phenyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 26880756 |
| Molecular Formula | C20H28N4O3S |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | N-[2-(diethylamino)-5-(diethylsulfamoyl)phenyl]pyridine-2-carboxamide |
| SMILES | CCN(CC)c1ccc(S(=O)(=O)N(CC)CC)cc1NC(=O)c1ccccn1 |
| InChI | InChI=1S/C20H28N4O3S/c1-5-23(6-2)19-13-12-16(28(26,27)24(7-3)8-4)15-18(19)22-20(25)17-11-9-10-14-21-17/h9-15H,5-8H2,1-4H3,(H,22,25) |
| InChIKey | JHPANFRAELTOQG-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |