C25H38N4O4S — CID 55409476
2-[2-(diethylamino)-5-(diethylsulfamoyl)anilino]-N-[1-(2-methoxyphenyl)ethyl]acetamide (PubChem CID 55409476) has the molecular formula C25H38N4O4S and a molecular weight of 490.67 g/mol. Its IUPAC name is 2-[2-(diethylamino)-5-(diethylsulfamoyl)anilino]-N-[1-(2-methoxyphenyl)ethyl]acetamide.
| Compound Name | 2-[2-(diethylamino)-5-(diethylsulfamoyl)anilino]-N-[1-(2-methoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 55409476 |
| Molecular Formula | C25H38N4O4S |
| Molecular Weight | 490.67 g/mol |
| Exact Mass | 490.26 |
| IUPAC Name | 2-[2-(diethylamino)-5-(diethylsulfamoyl)anilino]-N-[1-(2-methoxyphenyl)ethyl]acetamide |
| SMILES | CCN(CC)c1ccc(S(=O)(=O)N(CC)CC)cc1NCC(=O)NC(C)c1ccccc1OC |
| InChI | InChI=1S/C25H38N4O4S/c1-7-28(8-2)23-16-15-20(34(31,32)29(9-3)10-4)17-22(23)26-18-25(30)27-19(5)21-13-11-12-14-24(21)33-6/h11-17,19,26H,7-10,18H2,1-6H3,(H,27,30) |
| InChIKey | KXJLMFVUUQCXDC-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.67 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |