C27H32N2O5S — CID 43872602
2-[benzyl-(4-ethoxy-3-methylphenyl)sulfonylamino]-N-[1-(2-methoxyphenyl)ethyl]acetamide (PubChem CID 43872602) has the molecular formula C27H32N2O5S and a molecular weight of 496.63 g/mol. Its IUPAC name is 2-[benzyl-(4-ethoxy-3-methylphenyl)sulfonylamino]-N-[1-(2-methoxyphenyl)ethyl]acetamide.
| Compound Name | 2-[benzyl-(4-ethoxy-3-methylphenyl)sulfonylamino]-N-[1-(2-methoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 43872602 |
| Molecular Formula | C27H32N2O5S |
| Molecular Weight | 496.63 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | 2-[benzyl-(4-ethoxy-3-methylphenyl)sulfonylamino]-N-[1-(2-methoxyphenyl)ethyl]acetamide |
| SMILES | CCOc1ccc(S(=O)(=O)N(CC(=O)NC(C)c2ccccc2OC)Cc2ccccc2)cc1C |
| InChI | InChI=1S/C27H32N2O5S/c1-5-34-25-16-15-23(17-20(25)2)35(31,32)29(18-22-11-7-6-8-12-22)19-27(30)28-21(3)24-13-9-10-14-26(24)33-4/h6-17,21H,5,18-19H2,1-4H3,(H,28,30) |
| InChIKey | ZPTYXQAKJLIAIN-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.63 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |