C26H29BrN2O4S — CID 43872604
2-[benzyl-(4-ethoxy-3-methylphenyl)sulfonylamino]-N-[1-(3-bromophenyl)ethyl]acetamide (PubChem CID 43872604) has the molecular formula C26H29BrN2O4S and a molecular weight of 545.50 g/mol. Its IUPAC name is 2-[benzyl-(4-ethoxy-3-methylphenyl)sulfonylamino]-N-[1-(3-bromophenyl)ethyl]acetamide.
| Compound Name | 2-[benzyl-(4-ethoxy-3-methylphenyl)sulfonylamino]-N-[1-(3-bromophenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 43872604 |
| Molecular Formula | C26H29BrN2O4S |
| Molecular Weight | 545.50 g/mol |
| Exact Mass | 544.10 |
| IUPAC Name | 2-[benzyl-(4-ethoxy-3-methylphenyl)sulfonylamino]-N-[1-(3-bromophenyl)ethyl]acetamide |
| SMILES | CCOc1ccc(S(=O)(=O)N(CC(=O)NC(C)c2cccc(Br)c2)Cc2ccccc2)cc1C |
| InChI | InChI=1S/C26H29BrN2O4S/c1-4-33-25-14-13-24(15-19(25)2)34(31,32)29(17-21-9-6-5-7-10-21)18-26(30)28-20(3)22-11-8-12-23(27)16-22/h5-16,20H,4,17-18H2,1-3H3,(H,28,30) |
| InChIKey | ZBQDDMWLSBMYGR-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.50 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |