C23H22BrClN2O3S — CID 28543715
2-[benzyl-(4-chlorophenyl)sulfonylamino]-N-[(1S)-1-(3-bromophenyl)ethyl]acetamide (PubChem CID 28543715) has the molecular formula C23H22BrClN2O3S and a molecular weight of 521.86 g/mol. Its IUPAC name is 2-[benzyl-(4-chlorophenyl)sulfonylamino]-N-[(1S)-1-(3-bromophenyl)ethyl]acetamide.
| Compound Name | 2-[benzyl-(4-chlorophenyl)sulfonylamino]-N-[(1S)-1-(3-bromophenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 28543715 |
| Molecular Formula | C23H22BrClN2O3S |
| Molecular Weight | 521.86 g/mol |
| Exact Mass | 520.02 |
| IUPAC Name | 2-[benzyl-(4-chlorophenyl)sulfonylamino]-N-[(1S)-1-(3-bromophenyl)ethyl]acetamide |
| SMILES | C[C@H](NC(=O)CN(Cc1ccccc1)S(=O)(=O)c1ccc(Cl)cc1)c1cccc(Br)c1 |
| InChI | InChI=1S/C23H22BrClN2O3S/c1-17(19-8-5-9-20(24)14-19)26-23(28)16-27(15-18-6-3-2-4-7-18)31(29,30)22-12-10-21(25)11-13-22/h2-14,17H,15-16H2,1H3,(H,26,28)/t17-/m0/s1 |
| InChIKey | PYBIWSIKRUZFNG-KRWDZBQOSA-N |
| XLogP | 5.17 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.86 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |