C25H27BrN2O4S — CID 43872651
2-[benzyl-(4-ethoxyphenyl)sulfonylamino]-N-[1-(3-bromophenyl)ethyl]acetamide (PubChem CID 43872651) has the molecular formula C25H27BrN2O4S and a molecular weight of 531.47 g/mol. Its IUPAC name is 2-[benzyl-(4-ethoxyphenyl)sulfonylamino]-N-[1-(3-bromophenyl)ethyl]acetamide.
| Compound Name | 2-[benzyl-(4-ethoxyphenyl)sulfonylamino]-N-[1-(3-bromophenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 43872651 |
| Molecular Formula | C25H27BrN2O4S |
| Molecular Weight | 531.47 g/mol |
| Exact Mass | 530.09 |
| IUPAC Name | 2-[benzyl-(4-ethoxyphenyl)sulfonylamino]-N-[1-(3-bromophenyl)ethyl]acetamide |
| SMILES | CCOc1ccc(S(=O)(=O)N(CC(=O)NC(C)c2cccc(Br)c2)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C25H27BrN2O4S/c1-3-32-23-12-14-24(15-13-23)33(30,31)28(17-20-8-5-4-6-9-20)18-25(29)27-19(2)21-10-7-11-22(26)16-21/h4-16,19H,3,17-18H2,1-2H3,(H,27,29) |
| InChIKey | TZDJZKCYSLEIMR-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.47 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |