C24H24Br2N2O3S — CID 43871726
N-[1-(3-bromophenyl)ethyl]-2-[(4-bromophenyl)sulfonyl-(2-phenylethyl)amino]acetamide (PubChem CID 43871726) has the molecular formula C24H24Br2N2O3S and a molecular weight of 580.34 g/mol. Its IUPAC name is N-[1-(3-bromophenyl)ethyl]-2-[(4-bromophenyl)sulfonyl-(2-phenylethyl)amino]acetamide.
| Compound Name | N-[1-(3-bromophenyl)ethyl]-2-[(4-bromophenyl)sulfonyl-(2-phenylethyl)amino]acetamide |
|---|---|
| PubChem CID | 43871726 |
| Molecular Formula | C24H24Br2N2O3S |
| Molecular Weight | 580.34 g/mol |
| Exact Mass | 577.99 |
| IUPAC Name | N-[1-(3-bromophenyl)ethyl]-2-[(4-bromophenyl)sulfonyl-(2-phenylethyl)amino]acetamide |
| SMILES | CC(NC(=O)CN(CCc1ccccc1)S(=O)(=O)c1ccc(Br)cc1)c1cccc(Br)c1 |
| InChI | InChI=1S/C24H24Br2N2O3S/c1-18(20-8-5-9-22(26)16-20)27-24(29)17-28(15-14-19-6-3-2-4-7-19)32(30,31)23-12-10-21(25)11-13-23/h2-13,16,18H,14-15,17H2,1H3,(H,27,29) |
| InChIKey | MYTKHKJAIPFZGL-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.34 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |