C20H28N3O3S+ — CID 8827790
N-[5-(diethylsulfamoyl)-2-methylphenyl]-2-(2,3-dimethylpyridin-1-ium-1-yl)acetamide (PubChem CID 8827790) has the molecular formula C20H28N3O3S+ and a molecular weight of 390.53 g/mol. Its IUPAC name is N-[5-(diethylsulfamoyl)-2-methylphenyl]-2-(2,3-dimethylpyridin-1-ium-1-yl)acetamide.
| Compound Name | N-[5-(diethylsulfamoyl)-2-methylphenyl]-2-(2,3-dimethylpyridin-1-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 8827790 |
| Molecular Formula | C20H28N3O3S+ |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | N-[5-(diethylsulfamoyl)-2-methylphenyl]-2-(2,3-dimethylpyridin-1-ium-1-yl)acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C)c(NC(=O)C[n+]2cccc(C)c2C)c1 |
| InChI | InChI=1S/C20H27N3O3S/c1-6-23(7-2)27(25,26)18-11-10-16(4)19(13-18)21-20(24)14-22-12-8-9-15(3)17(22)5/h8-13H,6-7,14H2,1-5H3/p+1 |
| InChIKey | PPHSQPJBGCBNOO-UHFFFAOYSA-O |
| XLogP | 2.57 |
| TPSA | 70.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|