C17H23N3O5S — CID 7819474
N-[5-(diethylsulfamoyl)-2-methylphenyl]-2-(2,5-dioxopyrrolidin-1-yl)acetamide (PubChem CID 7819474) has the molecular formula C17H23N3O5S and a molecular weight of 381.45 g/mol. Its IUPAC name is N-[5-(diethylsulfamoyl)-2-methylphenyl]-2-(2,5-dioxopyrrolidin-1-yl)acetamide.
| Compound Name | N-[5-(diethylsulfamoyl)-2-methylphenyl]-2-(2,5-dioxopyrrolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 7819474 |
| Molecular Formula | C17H23N3O5S |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | N-[5-(diethylsulfamoyl)-2-methylphenyl]-2-(2,5-dioxopyrrolidin-1-yl)acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C)c(NC(=O)CN2C(=O)CCC2=O)c1 |
| InChI | InChI=1S/C17H23N3O5S/c1-4-19(5-2)26(24,25)13-7-6-12(3)14(10-13)18-15(21)11-20-16(22)8-9-17(20)23/h6-7,10H,4-5,8-9,11H2,1-3H3,(H,18,21) |
| InChIKey | AQGZGNQTLQOFNF-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|