C22H25N5O5S — CID 24529074
3-[2-[5-(diethylsulfamoyl)-2-methylanilino]-2-oxoethyl]-4-oxophthalazine-1-carboxamide (PubChem CID 24529074) has the molecular formula C22H25N5O5S and a molecular weight of 471.54 g/mol. Its IUPAC name is 3-[2-[5-(diethylsulfamoyl)-2-methylanilino]-2-oxoethyl]-4-oxophthalazine-1-carboxamide.
| Compound Name | 3-[2-[5-(diethylsulfamoyl)-2-methylanilino]-2-oxoethyl]-4-oxophthalazine-1-carboxamide |
|---|---|
| PubChem CID | 24529074 |
| Molecular Formula | C22H25N5O5S |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | 3-[2-[5-(diethylsulfamoyl)-2-methylanilino]-2-oxoethyl]-4-oxophthalazine-1-carboxamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C)c(NC(=O)Cn2nc(C(N)=O)c3ccccc3c2=O)c1 |
| InChI | InChI=1S/C22H25N5O5S/c1-4-26(5-2)33(31,32)15-11-10-14(3)18(12-15)24-19(28)13-27-22(30)17-9-7-6-8-16(17)20(25-27)21(23)29/h6-12H,4-5,13H2,1-3H3,(H2,23,29)(H,24,28) |
| InChIKey | VNUDXMUQCBODNN-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 144.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |